Association between breast cancer susceptibility and variation in the catalase gene in women from Babylon, Iraq
Fuente:
Zenodo
Guardado en:
| Autor principal: | |
|---|---|
| Formato: | Recurso digital |
| Publicado: |
Zenodo
2025
|
| Materias: | |
| Acceso en línea: | |
| Etiquetas: |
Agregar Etiqueta
Sin Etiquetas, Sea el primero en etiquetar este registro!
|
| _version_ | 1866901740703449088 |
|---|---|
| author | Salah Hashim Shaheed |
| author_facet | Salah Hashim Shaheed |
| contents | <p>Catalase0represents a critical enzyme in the organism's defense system against oxidative stress, a physiolog1qaical state<br>implicated in the pathogenesis of various cancers. As a primary antioxidant defense enzyme, catalase plays a vital role in mitigating<br>oxidative damage. Substantial evidence from numerous studies indicates that genetic polymorphisms in the CAT gene are significant<br>in cancer etiology. This investigation aimed to elucidate the influence of the CAT gene polymorphism0(rs7943316)0on breast cancer<br>susceptibility. Genomic DNA was isolated from blood samples of breast cancer patients and a control cohort. The specified0singlenucleotide0polymorphism (SNP) was analyzed using polymerase.chain reaction (PCR) coupled with restriction<br>fragment0length.polymorphism (RFLP)0analysis. Genotype distribution in the control group was as follows: the heterozygous A/T<br>genotype was most prevalent0(55 %), followed0by the homozygous T/T genotype (36.7%), while the homozygous A/A genotype was<br>not0observed (8.3 %). In the breast cancer (BC) patient group, the A/T0genotype was also the most frequent (51.7%), followed by T/T<br>(31.7%) and A/A (16.6%).Analysis revealed that individuals carrying the A/T and T/T genotypes exhibited an elevated odds ratio for<br>breast cancer development (OR = 2.129, P = 0.209 and OR = 2.315, P = 0.183, respectively). However, these associations were not<br>statistically significant. Furthermore, comparative allele frequency analysis showed no significant difference in the distribution of<br>the0T.allele of the CAT gene (.rs7943316)0between the breast cancer0patients and the control group (P = 0.290). In conclusion, the<br>findings of this study indicate that the development of breast cancer is not associated with polymorphisms of the CAT gene at the<br>rs7943316 locus.</p> |
| format | Recurso digital |
| id | zenodo_https___doi_org_10_5281_zenodo_17336794 |
| institution | Zenodo |
| language | |
| publishDate | 2025 |
| publisher | Zenodo |
| record_format | zenodo |
| spellingShingle | Association between breast cancer susceptibility and variation in the catalase gene in women from Babylon, Iraq Salah Hashim Shaheed rs7943316; SNP promoter; Breast Cancer Susceptibility; Oxidative Stress. <p>Catalase0represents a critical enzyme in the organism's defense system against oxidative stress, a physiolog1qaical state<br>implicated in the pathogenesis of various cancers. As a primary antioxidant defense enzyme, catalase plays a vital role in mitigating<br>oxidative damage. Substantial evidence from numerous studies indicates that genetic polymorphisms in the CAT gene are significant<br>in cancer etiology. This investigation aimed to elucidate the influence of the CAT gene polymorphism0(rs7943316)0on breast cancer<br>susceptibility. Genomic DNA was isolated from blood samples of breast cancer patients and a control cohort. The specified0singlenucleotide0polymorphism (SNP) was analyzed using polymerase.chain reaction (PCR) coupled with restriction<br>fragment0length.polymorphism (RFLP)0analysis. Genotype distribution in the control group was as follows: the heterozygous A/T<br>genotype was most prevalent0(55 %), followed0by the homozygous T/T genotype (36.7%), while the homozygous A/A genotype was<br>not0observed (8.3 %). In the breast cancer (BC) patient group, the A/T0genotype was also the most frequent (51.7%), followed by T/T<br>(31.7%) and A/A (16.6%).Analysis revealed that individuals carrying the A/T and T/T genotypes exhibited an elevated odds ratio for<br>breast cancer development (OR = 2.129, P = 0.209 and OR = 2.315, P = 0.183, respectively). However, these associations were not<br>statistically significant. Furthermore, comparative allele frequency analysis showed no significant difference in the distribution of<br>the0T.allele of the CAT gene (.rs7943316)0between the breast cancer0patients and the control group (P = 0.290). In conclusion, the<br>findings of this study indicate that the development of breast cancer is not associated with polymorphisms of the CAT gene at the<br>rs7943316 locus.</p> |
| title | Association between breast cancer susceptibility and variation in the catalase gene in women from Babylon, Iraq |
| topic | rs7943316; SNP promoter; Breast Cancer Susceptibility; Oxidative Stress. |
| url | https://doi.org/10.5281/zenodo.17336794 |